C15H26F2OSi — CID 15419454
1-[(2R,3aS,7aS)-2-[tert-butyl(difluoro)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone (PubChem CID 15419454) has the molecular formula C15H26F2OSi and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-2-[tert-butyl(difluoro)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-2-[tert-butyl(difluoro)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
|---|---|
| PubChem CID | 15419454 |
| Molecular Formula | C15H26F2OSi |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-[(2R,3aS,7aS)-2-[tert-butyl(difluoro)silyl]-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C[C@@H]([Si](F)(F)C(C)(C)C)C2 |
| InChI | InChI=1S/C15H26F2OSi/c1-11(18)15-8-6-5-7-12(15)9-13(10-15)19(16,17)14(2,3)4/h12-13H,5-10H2,1-4H3/t12-,13+,15+/m0/s1 |
| InChIKey | WLLJOJZMVBMAAF-GZBFAFLISA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|