About [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate
[(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate (PubChem CID 15419485) has the molecular formula C21H17NO4
and a molecular weight of 347.37 g/mol. Its IUPAC name is [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate.
Molecular Properties
| Compound Name | [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate |
| PubChem CID | 15419485 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate |
| SMILES | COc1ccc2ccccc2c1[C@@H]1NC(=O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17NO4/c1-25-16-12-11-13-7-5-6-10-15(13)17(16)18-19(20(23)22-18)26-21(24)14-8-3-2-4-9-14/h2-12,18-19H,1H3,(H,22,23)/t18-,19-/m0/s1 |
| InChIKey | KNKIZWKDDIRDBJ-OALUTQOASA-N |
| XLogP | 3.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate?
The IUPAC name of [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate (CID 15419485) is [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate.
What is the SMILES notation for [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate?
The canonical SMILES for [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate is COc1ccc2ccccc2c1[C@@H]1NC(=O)[C@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate?
The InChIKey is KNKIZWKDDIRDBJ-OALUTQOASA-N. The full InChI is InChI=1S/C21H17NO4/c1-25-16-12-11-13-7-5-6-10-15(13)17(16)18-19(20(23)22-18)26-21(24)14-8-3-2-4-9-14/h2-12,18-19H,1H3,(H,22,23)/t18-,19-/m0/s1.
What are the key properties of [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate?
[(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate has a molecular weight of 347.37 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-(2-methoxynaphthalen-1-yl)-4-oxoazetidin-3-yl] benzoate is sourced from PubChem (CID 15419485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).