About chromen-2-imine
chromen-2-imine (PubChem CID 15419563) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is chromen-2-imine.
Molecular Properties
| Compound Name | chromen-2-imine |
| PubChem CID | 15419563 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | chromen-2-imine |
| SMILES | [H]/N=c1\ccc2ccccc2o1 |
| InChI | InChI=1S/C9H7NO/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,10H/b10-9+ |
| InChIKey | WUVFAMRFBRHSQW-MDZDMXLPSA-N |
| XLogP | 1.91 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chromen-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-imine?
The IUPAC name of chromen-2-imine (CID 15419563) is chromen-2-imine.
What is the SMILES notation for chromen-2-imine?
The canonical SMILES for chromen-2-imine is [H]/N=c1\ccc2ccccc2o1.
What is the InChIKey of chromen-2-imine?
The InChIKey is WUVFAMRFBRHSQW-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H7NO/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,10H/b10-9+.
What are the key properties of chromen-2-imine?
chromen-2-imine has a molecular weight of 145.16 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-imine is sourced from PubChem (CID 15419563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).