About 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol
3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol (PubChem CID 154196116) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol.
Molecular Properties
| Compound Name | 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol |
| PubChem CID | 154196116 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol |
| SMILES | C=CC(O)(C=C)c1ccccc1C(O)(C=C)C=C |
| InChI | InChI=1S/C16H18O2/c1-5-15(17,6-2)13-11-9-10-12-14(13)16(18,7-3)8-4/h5-12,17-18H,1-4H2 |
| InChIKey | PWRZOQJIHBFPJQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol?
The IUPAC name of 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol (CID 154196116) is 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol.
What is the SMILES notation for 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol?
The canonical SMILES for 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol is C=CC(O)(C=C)c1ccccc1C(O)(C=C)C=C.
What is the InChIKey of 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol?
The InChIKey is PWRZOQJIHBFPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O2/c1-5-15(17,6-2)13-11-9-10-12-14(13)16(18,7-3)8-4/h5-12,17-18H,1-4H2.
What are the key properties of 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol?
3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol has a molecular weight of 242.32 g/mol, XLogP of 2.81, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-hydroxypenta-1,4-dien-3-yl)phenyl]penta-1,4-dien-3-ol is sourced from PubChem (CID 154196116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).