C10H11NO8 — CID 154196332
2-cyano-1-methoxycarbonylbutane-1,1,2-tricarboxylic acid (PubChem CID 154196332) has the molecular formula C10H11NO8 and a molecular weight of 273.20 g/mol. Its IUPAC name is 2-cyano-1-methoxycarbonylbutane-1,1,2-tricarboxylic acid.
| Compound Name | 2-cyano-1-methoxycarbonylbutane-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 154196332 |
| Molecular Formula | C10H11NO8 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-cyano-1-methoxycarbonylbutane-1,1,2-tricarboxylic acid |
| SMILES | CCC(C#N)(C(=O)O)C(C(=O)O)(C(=O)O)C(=O)OC |
| InChI | InChI=1S/C10H11NO8/c1-3-9(4-11,5(12)13)10(6(14)15,7(16)17)8(18)19-2/h3H2,1-2H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | NDJDRXYEVRAXGP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|