About 2-chloropropoxysilane
2-chloropropoxysilane (PubChem CID 154197021) has the molecular formula C3H9ClOSi
and a molecular weight of 124.64 g/mol. Its IUPAC name is 2-chloropropoxysilane.
Molecular Properties
| Compound Name | 2-chloropropoxysilane |
| PubChem CID | 154197021 |
| Molecular Formula | C3H9ClOSi |
| Molecular Weight | 124.64 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | 2-chloropropoxysilane |
| SMILES | CC(Cl)CO[SiH3] |
| InChI | InChI=1S/C3H9ClOSi/c1-3(4)2-5-6/h3H,2H2,1,6H3 |
| InChIKey | KQYLLTBLCUNTNV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.64 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropoxysilane?
The IUPAC name of 2-chloropropoxysilane (CID 154197021) is 2-chloropropoxysilane.
What is the SMILES notation for 2-chloropropoxysilane?
The canonical SMILES for 2-chloropropoxysilane is CC(Cl)CO[SiH3].
What is the InChIKey of 2-chloropropoxysilane?
The InChIKey is KQYLLTBLCUNTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9ClOSi/c1-3(4)2-5-6/h3H,2H2,1,6H3.
What are the key properties of 2-chloropropoxysilane?
2-chloropropoxysilane has a molecular weight of 124.64 g/mol, XLogP of -0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropoxysilane is sourced from PubChem (CID 154197021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).