C24H24F3N3O2S — CID 154198222
N-[(3S,3aR,7aR)-2-cyano-6,6-difluoro-3-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-1H-inden-2-yl]methanesulfonamide (PubChem CID 154198222) has the molecular formula C24H24F3N3O2S and a molecular weight of 475.54 g/mol. Its IUPAC name is N-[(3S,3aR,7aR)-2-cyano-6,6-difluoro-3-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-1H-inden-2-yl]methanesulfonamide.
| Compound Name | N-[(3S,3aR,7aR)-2-cyano-6,6-difluoro-3-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-1H-inden-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 154198222 |
| Molecular Formula | C24H24F3N3O2S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[(3S,3aR,7aR)-2-cyano-6,6-difluoro-3-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,3a,4,5,7,7a-hexahydro-1H-inden-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1(C#N)C[C@@H]2CC(F)(F)CC[C@H]2[C@@H]1C=Cc1ccc(-c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C24H24F3N3O2S/c1-33(31,32)30-23(15-28)12-18-13-24(26,27)10-9-21(18)22(23)8-7-20-6-5-17(14-29-20)16-3-2-4-19(25)11-16/h2-8,11,14,18,21-22,30H,9-10,12-13H2,1H3/t18-,21-,22+,23?/m1/s1 |
| InChIKey | FYWFZMBTDQDDKX-ZYGDZFMBSA-N |
| XLogP | 4.78 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |