About 2-ethyl-3-phenyl-2H-1,4-benzothiazine
2-ethyl-3-phenyl-2H-1,4-benzothiazine (PubChem CID 154198566) has the molecular formula C16H15NS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-ethyl-3-phenyl-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 2-ethyl-3-phenyl-2H-1,4-benzothiazine |
| PubChem CID | 154198566 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-ethyl-3-phenyl-2H-1,4-benzothiazine |
| SMILES | CCC1Sc2ccccc2N=C1c1ccccc1 |
| InChI | InChI=1S/C16H15NS/c1-2-14-16(12-8-4-3-5-9-12)17-13-10-6-7-11-15(13)18-14/h3-11,14H,2H2,1H3 |
| InChIKey | OJCGGBZAJCBWCU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-phenyl-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-phenyl-2H-1,4-benzothiazine?
The IUPAC name of 2-ethyl-3-phenyl-2H-1,4-benzothiazine (CID 154198566) is 2-ethyl-3-phenyl-2H-1,4-benzothiazine.
What is the SMILES notation for 2-ethyl-3-phenyl-2H-1,4-benzothiazine?
The canonical SMILES for 2-ethyl-3-phenyl-2H-1,4-benzothiazine is CCC1Sc2ccccc2N=C1c1ccccc1.
What is the InChIKey of 2-ethyl-3-phenyl-2H-1,4-benzothiazine?
The InChIKey is OJCGGBZAJCBWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NS/c1-2-14-16(12-8-4-3-5-9-12)17-13-10-6-7-11-15(13)18-14/h3-11,14H,2H2,1H3.
What are the key properties of 2-ethyl-3-phenyl-2H-1,4-benzothiazine?
2-ethyl-3-phenyl-2H-1,4-benzothiazine has a molecular weight of 253.37 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-phenyl-2H-1,4-benzothiazine is sourced from PubChem (CID 154198566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).