About 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol
1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol (PubChem CID 154198602) has the molecular formula C15H27Cl3O
and a molecular weight of 329.74 g/mol. Its IUPAC name is 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
| PubChem CID | 154198602 |
| Molecular Formula | C15H27Cl3O |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)C1CCC(O)(C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C15H27Cl3O/c1-12(2,3)10-13(4,5)11-6-8-14(19,9-7-11)15(16,17)18/h11,19H,6-10H2,1-5H3 |
| InChIKey | RGFIOPMGYXCIKT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The IUPAC name of 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol (CID 154198602) is 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The canonical SMILES for 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol is CC(C)(C)CC(C)(C)C1CCC(O)(C(Cl)(Cl)Cl)CC1.
What is the InChIKey of 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
The InChIKey is RGFIOPMGYXCIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27Cl3O/c1-12(2,3)10-13(4,5)11-6-8-14(19,9-7-11)15(16,17)18/h11,19H,6-10H2,1-5H3.
What are the key properties of 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol?
1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol has a molecular weight of 329.74 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trichloromethyl)-4-(2,4,4-trimethylpentan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 154198602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).