About (5S)-5-buta-2,3-dienylpyrrolidin-2-one
(5S)-5-buta-2,3-dienylpyrrolidin-2-one (PubChem CID 15420014) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (5S)-5-buta-2,3-dienylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-buta-2,3-dienylpyrrolidin-2-one |
| PubChem CID | 15420014 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (5S)-5-buta-2,3-dienylpyrrolidin-2-one |
| SMILES | C=C=CC[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C8H11NO/c1-2-3-4-7-5-6-8(10)9-7/h3,7H,1,4-6H2,(H,9,10)/t7-/m1/s1 |
| InChIKey | VGUWXRZCEWJTAT-SSDOTTSWSA-N |
| XLogP | 1.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S)-5-buta-2,3-dienylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-buta-2,3-dienylpyrrolidin-2-one?
The IUPAC name of (5S)-5-buta-2,3-dienylpyrrolidin-2-one (CID 15420014) is (5S)-5-buta-2,3-dienylpyrrolidin-2-one.
What is the SMILES notation for (5S)-5-buta-2,3-dienylpyrrolidin-2-one?
The canonical SMILES for (5S)-5-buta-2,3-dienylpyrrolidin-2-one is C=C=CC[C@@H]1CCC(=O)N1.
What is the InChIKey of (5S)-5-buta-2,3-dienylpyrrolidin-2-one?
The InChIKey is VGUWXRZCEWJTAT-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11NO/c1-2-3-4-7-5-6-8(10)9-7/h3,7H,1,4-6H2,(H,9,10)/t7-/m1/s1.
What are the key properties of (5S)-5-buta-2,3-dienylpyrrolidin-2-one?
(5S)-5-buta-2,3-dienylpyrrolidin-2-one has a molecular weight of 137.18 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-buta-2,3-dienylpyrrolidin-2-one is sourced from PubChem (CID 15420014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).