C20H31N — CID 154201362
1-[1-(1-adamantyl)cyclohexa-2,4-dien-1-yl]butan-1-amine (PubChem CID 154201362) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)cyclohexa-2,4-dien-1-yl]butan-1-amine.
| Compound Name | 1-[1-(1-adamantyl)cyclohexa-2,4-dien-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 154201362 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[1-(1-adamantyl)cyclohexa-2,4-dien-1-yl]butan-1-amine |
| SMILES | CCCC(N)C1(C23CC4CC(CC(C4)C2)C3)C=CC=CC1 |
| InChI | InChI=1S/C20H31N/c1-2-6-18(21)20(7-4-3-5-8-20)19-12-15-9-16(13-19)11-17(10-15)14-19/h3-5,7,15-18H,2,6,8-14,21H2,1H3 |
| InChIKey | XREPSDIJVYJIKK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |