About 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol
2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol (PubChem CID 154201580) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 154201580 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol |
| SMILES | CC(C)(C)C1=C(O)C(C)(C(C)(C)C)CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C21H30O/c1-19(2,3)17-13-16(15-11-9-8-10-12-15)14-21(7,18(17)22)20(4,5)6/h8-13,22H,14H2,1-7H3 |
| InChIKey | XKJJMHGNHSIMAO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol (CID 154201580) is 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol is CC(C)(C)C1=C(O)C(C)(C(C)(C)C)CC(c2ccccc2)=C1.
What is the InChIKey of 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol?
The InChIKey is XKJJMHGNHSIMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O/c1-19(2,3)17-13-16(15-11-9-8-10-12-15)14-21(7,18(17)22)20(4,5)6/h8-13,22H,14H2,1-7H3.
What are the key properties of 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol?
2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol has a molecular weight of 298.47 g/mol, XLogP of 6.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-6-methyl-4-phenylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 154201580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).