About 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one
2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one (PubChem CID 154202632) has the molecular formula C15H10F3NO2
and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one |
| PubChem CID | 154202632 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one |
| SMILES | O=C1Nc2cc(C(F)(F)F)ccc2OCc2ccccc21 |
| InChI | InChI=1S/C15H10F3NO2/c16-15(17,18)10-5-6-13-12(7-10)19-14(20)11-4-2-1-3-9(11)8-21-13/h1-7H,8H2,(H,19,20) |
| InChIKey | NLFHJBINWYTGEL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one?
The IUPAC name of 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one (CID 154202632) is 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one.
What is the SMILES notation for 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one?
The canonical SMILES for 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one is O=C1Nc2cc(C(F)(F)F)ccc2OCc2ccccc21.
What is the InChIKey of 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one?
The InChIKey is NLFHJBINWYTGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3NO2/c16-15(17,18)10-5-6-13-12(7-10)19-14(20)11-4-2-1-3-9(11)8-21-13/h1-7H,8H2,(H,19,20).
What are the key properties of 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one?
2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one has a molecular weight of 293.24 g/mol, XLogP of 3.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-6,12-dihydrobenzo[c][1,6]benzoxazocin-11-one is sourced from PubChem (CID 154202632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).