About 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one
6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 154203375) has the molecular formula C13H10ClF3N2O3
and a molecular weight of 334.68 g/mol. Its IUPAC name is 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| PubChem CID | 154203375 |
| Molecular Formula | C13H10ClF3N2O3 |
| Molecular Weight | 334.68 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C(CN2C=COC2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C13H10ClF3N2O3/c14-8-1-2-10-9(5-8)12(13(15,16)17,22-11(20)18-10)6-19-3-4-21-7-19/h1-5H,6-7H2,(H,18,20) |
| InChIKey | BOICLOVEYBNAGT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The IUPAC name of 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CID 154203375) is 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The canonical SMILES for 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is O=C1Nc2ccc(Cl)cc2C(CN2C=COC2)(C(F)(F)F)O1.
What is the InChIKey of 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The InChIKey is BOICLOVEYBNAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClF3N2O3/c14-8-1-2-10-9(5-8)12(13(15,16)17,22-11(20)18-10)6-19-3-4-21-7-19/h1-5H,6-7H2,(H,18,20).
What are the key properties of 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one has a molecular weight of 334.68 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-(2H-1,3-oxazol-3-ylmethyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is sourced from PubChem (CID 154203375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).