C7H7NO2S — CID 154205341
5-methyl-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 154205341) has the molecular formula C7H7NO2S and a molecular weight of 169.20 g/mol. Its IUPAC name is 5-methyl-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-methyl-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154205341 |
| Molecular Formula | C7H7NO2S |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 5-methyl-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)SC(C)C1=O |
| InChI | InChI=1S/C7H7NO2S/c1-3-4-8-6(9)5(2)11-7(8)10/h1,5H,4H2,2H3 |
| InChIKey | GVGRWLGUZTZMJR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|