C45H18F51O3P — CID 15420596
tris[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylphenyl] phosphite (PubChem CID 15420596) has the molecular formula C45H18F51O3P and a molecular weight of 1606.51 g/mol. Its IUPAC name is tris[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylphenyl] phosphite.
| Compound Name | tris[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylphenyl] phosphite |
|---|---|
| PubChem CID | 15420596 |
| Molecular Formula | C45H18F51O3P |
| Molecular Weight | 1606.51 g/mol |
| Exact Mass | 1606.02 |
| IUPAC Name | tris[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylphenyl] phosphite |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1OP(Oc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1C)Oc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C45H18F51O3P/c1-13-10-16(22(46,47)25(52,53)28(58,59)31(64,65)34(70,71)37(76,77)40(82,83)43(88,89)90)4-7-19(13)97-100(98-20-8-5-17(11-14(20)2)23(48,49)26(54,55)29(60,61)32(66,67)35(72,73)38(78,79)41(84,85)44(91,92)93)99-21-9-6-18(12-15(21)3)24(50,51)27(56,57)30(62,63)33(68,69)36(74,75)39(80,81)42(86,87)45(94,95)96/h4-12H,1-3H3 |
| InChIKey | NUCWVTZPPPBHJA-UHFFFAOYSA-N |
| XLogP | 22.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1606.51 |
| LogP ≤ 5 | 22.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|