About 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one
4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one (PubChem CID 154206821) has the molecular formula C7H6F3NO
and a molecular weight of 177.12 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one |
| PubChem CID | 154206821 |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(CC(F)(F)F)cc[nH]1 |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)4-5-1-2-11-6(12)3-5/h1-3H,4H2,(H,11,12) |
| InChIKey | MCFBTSHKHDQYTH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one?
The IUPAC name of 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one (CID 154206821) is 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one.
What is the SMILES notation for 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one?
The canonical SMILES for 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one is O=c1cc(CC(F)(F)F)cc[nH]1.
What is the InChIKey of 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one?
The InChIKey is MCFBTSHKHDQYTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO/c8-7(9,10)4-5-1-2-11-6(12)3-5/h1-3H,4H2,(H,11,12).
What are the key properties of 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one?
4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one has a molecular weight of 177.12 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoroethyl)-1H-pyridin-2-one is sourced from PubChem (CID 154206821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).