C21H25F5N4O3 — CID 154207469
7-(7-amino-6,6-difluoro-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methoxy-6,7-dihydroquinazoline-2,4-dione (PubChem CID 154207469) has the molecular formula C21H25F5N4O3 and a molecular weight of 476.45 g/mol. Its IUPAC name is 7-(7-amino-6,6-difluoro-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methoxy-6,7-dihydroquinazoline-2,4-dione.
| Compound Name | 7-(7-amino-6,6-difluoro-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methoxy-6,7-dihydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 154207469 |
| Molecular Formula | C21H25F5N4O3 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 7-(7-amino-6,6-difluoro-3,3a,4,5,7,7a-hexahydro-1H-isoindol-2-yl)-1-cyclopropyl-5-(difluoromethyl)-6-fluoro-8-methoxy-6,7-dihydroquinazoline-2,4-dione |
| SMILES | COC1=c2c(c(=O)[nH]c(=O)n2C2CC2)=C(C(F)F)C(F)C1N1CC2CCC(F)(F)C(N)C2C1 |
| InChI | InChI=1S/C21H25F5N4O3/c1-33-16-14-12(19(31)28-20(32)30(14)9-2-3-9)11(18(23)24)13(22)15(16)29-6-8-4-5-21(25,26)17(27)10(8)7-29/h8-10,13,15,17-18H,2-7,27H2,1H3,(H,28,31,32) |
| InChIKey | LPKNKQKFZJKKDN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |