C19H19BrN2S — CID 15420790
1-benzyl-2-phenyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide (PubChem CID 15420790) has the molecular formula C19H19BrN2S and a molecular weight of 387.35 g/mol. Its IUPAC name is 1-benzyl-2-phenyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide.
| Compound Name | 1-benzyl-2-phenyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
|---|---|
| PubChem CID | 15420790 |
| Molecular Formula | C19H19BrN2S |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-benzyl-2-phenyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium bromide |
| SMILES | [Br-].c1ccc(Cn2c(-c3ccccc3)c[n+]3c2SCCC3)cc1 |
| InChI | InChI=1S/C19H19N2S.BrH/c1-3-8-16(9-4-1)14-21-18(17-10-5-2-6-11-17)15-20-12-7-13-22-19(20)21;/h1-6,8-11,15H,7,12-14H2;1H/q+1;/p-1 |
| InChIKey | VRUCDBICUOTKIR-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|