C15H32N2O — CID 15420794
3,6,10,13-tetramethyl-1-oxa-6,10-diazacyclotetradecane (PubChem CID 15420794) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 3,6,10,13-tetramethyl-1-oxa-6,10-diazacyclotetradecane.
| Compound Name | 3,6,10,13-tetramethyl-1-oxa-6,10-diazacyclotetradecane |
|---|---|
| PubChem CID | 15420794 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 3,6,10,13-tetramethyl-1-oxa-6,10-diazacyclotetradecane |
| SMILES | CC1CCN(C)CCCN(C)CCC(C)COC1 |
| InChI | InChI=1S/C15H32N2O/c1-14-6-10-16(3)8-5-9-17(4)11-7-15(2)13-18-12-14/h14-15H,5-13H2,1-4H3 |
| InChIKey | BHIAGQQMLMLMBF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |