About 4-diazenyl-2H-1,2-oxazol-5-one
4-diazenyl-2H-1,2-oxazol-5-one (PubChem CID 154208588) has the molecular formula C3H3N3O2
and a molecular weight of 113.08 g/mol. Its IUPAC name is 4-diazenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-diazenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 154208588 |
| Molecular Formula | C3H3N3O2 |
| Molecular Weight | 113.08 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | 4-diazenyl-2H-1,2-oxazol-5-one |
| SMILES | [H]/N=N/c1c[nH]oc1=O |
| InChI | InChI=1S/C3H3N3O2/c4-6-2-1-5-8-3(2)7/h1,4-5H/b6-4+ |
| InChIKey | UYKXLXBFJUHRRK-GQCTYLIASA-N |
| XLogP | 0.63 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.08 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenyl-2H-1,2-oxazol-5-one?
The IUPAC name of 4-diazenyl-2H-1,2-oxazol-5-one (CID 154208588) is 4-diazenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 4-diazenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 4-diazenyl-2H-1,2-oxazol-5-one is [H]/N=N/c1c[nH]oc1=O.
What is the InChIKey of 4-diazenyl-2H-1,2-oxazol-5-one?
The InChIKey is UYKXLXBFJUHRRK-GQCTYLIASA-N. The full InChI is InChI=1S/C3H3N3O2/c4-6-2-1-5-8-3(2)7/h1,4-5H/b6-4+.
What are the key properties of 4-diazenyl-2H-1,2-oxazol-5-one?
4-diazenyl-2H-1,2-oxazol-5-one has a molecular weight of 113.08 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 154208588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).