C20H4Cl14O2 — CID 154209465
1,2,3,4,5-pentachloro-6-[[2,3,5,6-tetrachloro-4-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]methoxy]benzene (PubChem CID 154209465) has the molecular formula C20H4Cl14O2 and a molecular weight of 772.59 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[[2,3,5,6-tetrachloro-4-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]methoxy]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[[2,3,5,6-tetrachloro-4-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 154209465 |
| Molecular Formula | C20H4Cl14O2 |
| Molecular Weight | 772.59 g/mol |
| Exact Mass | 765.59 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[[2,3,5,6-tetrachloro-4-[(2,3,4,5,6-pentachlorophenoxy)methyl]phenyl]methoxy]benzene |
| SMILES | Clc1c(Cl)c(Cl)c(OCc2c(Cl)c(Cl)c(COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C20H4Cl14O2/c21-5-3(1-35-19-15(31)11(27)9(25)12(28)16(19)32)6(22)8(24)4(7(5)23)2-36-20-17(33)13(29)10(26)14(30)18(20)34/h1-2H2 |
| InChIKey | PGAIPDQUMUPMIE-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.59 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|