About 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine
4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 154209959) has the molecular formula C13H12F3N3
and a molecular weight of 267.25 g/mol. Its IUPAC name is 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 154209959 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1(C(F)(F)F)C=CC(/N=N/c2ccccc2)=CC1 |
| InChI | InChI=1S/C13H12F3N3/c14-13(15,16)12(17)8-6-11(7-9-12)19-18-10-4-2-1-3-5-10/h1-8H,9,17H2/b19-18+ |
| InChIKey | KVEGYOXGAUENHU-VHEBQXMUSA-N |
| XLogP | 3.87 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (CID 154209959) is 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is NC1(C(F)(F)F)C=CC(/N=N/c2ccccc2)=CC1.
What is the InChIKey of 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is KVEGYOXGAUENHU-VHEBQXMUSA-N. The full InChI is InChI=1S/C13H12F3N3/c14-13(15,16)12(17)8-6-11(7-9-12)19-18-10-4-2-1-3-5-10/h1-8H,9,17H2/b19-18+.
What are the key properties of 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine?
4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 267.25 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenyl-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 154209959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).