About 2-cyclopropyl-1H-pyridine-2,3,4-triamine
2-cyclopropyl-1H-pyridine-2,3,4-triamine (PubChem CID 154210946) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-cyclopropyl-1H-pyridine-2,3,4-triamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-1H-pyridine-2,3,4-triamine |
| PubChem CID | 154210946 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-cyclopropyl-1H-pyridine-2,3,4-triamine |
| SMILES | NC1=C(N)C(N)(C2CC2)NC=C1 |
| InChI | InChI=1S/C8H14N4/c9-6-3-4-12-8(11,7(6)10)5-1-2-5/h3-5,12H,1-2,9-11H2 |
| InChIKey | XTFPJNQCBLIMLN-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-1H-pyridine-2,3,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1H-pyridine-2,3,4-triamine?
The IUPAC name of 2-cyclopropyl-1H-pyridine-2,3,4-triamine (CID 154210946) is 2-cyclopropyl-1H-pyridine-2,3,4-triamine.
What is the SMILES notation for 2-cyclopropyl-1H-pyridine-2,3,4-triamine?
The canonical SMILES for 2-cyclopropyl-1H-pyridine-2,3,4-triamine is NC1=C(N)C(N)(C2CC2)NC=C1.
What is the InChIKey of 2-cyclopropyl-1H-pyridine-2,3,4-triamine?
The InChIKey is XTFPJNQCBLIMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c9-6-3-4-12-8(11,7(6)10)5-1-2-5/h3-5,12H,1-2,9-11H2.
What are the key properties of 2-cyclopropyl-1H-pyridine-2,3,4-triamine?
2-cyclopropyl-1H-pyridine-2,3,4-triamine has a molecular weight of 166.23 g/mol, XLogP of -0.70, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1H-pyridine-2,3,4-triamine is sourced from PubChem (CID 154210946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).