About 5-chloro-2,3-dihydronaphthalene
5-chloro-2,3-dihydronaphthalene (PubChem CID 154214824) has the molecular formula C10H9Cl
and a molecular weight of 164.63 g/mol. Its IUPAC name is 5-chloro-2,3-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-chloro-2,3-dihydronaphthalene |
| PubChem CID | 154214824 |
| Molecular Formula | C10H9Cl |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 5-chloro-2,3-dihydronaphthalene |
| SMILES | Clc1cccc2c1=CCCC=2 |
| InChI | InChI=1S/C10H9Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3-7H,1-2H2 |
| InChIKey | JECZABAUKQFIJY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-chloro-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,3-dihydronaphthalene?
The IUPAC name of 5-chloro-2,3-dihydronaphthalene (CID 154214824) is 5-chloro-2,3-dihydronaphthalene.
What is the SMILES notation for 5-chloro-2,3-dihydronaphthalene?
The canonical SMILES for 5-chloro-2,3-dihydronaphthalene is Clc1cccc2c1=CCCC=2.
What is the InChIKey of 5-chloro-2,3-dihydronaphthalene?
The InChIKey is JECZABAUKQFIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3-7H,1-2H2.
What are the key properties of 5-chloro-2,3-dihydronaphthalene?
5-chloro-2,3-dihydronaphthalene has a molecular weight of 164.63 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,3-dihydronaphthalene is sourced from PubChem (CID 154214824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).