About 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one
7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one (PubChem CID 15421911) has the molecular formula C6H7N5O2
and a molecular weight of 181.16 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one |
| PubChem CID | 15421911 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one |
| SMILES | Cn1nnc2c(ncn2CO)c1=O |
| InChI | InChI=1S/C6H7N5O2/c1-10-6(13)4-5(8-9-10)11(3-12)2-7-4/h2,12H,3H2,1H3 |
| InChIKey | PYNKESOTRZEPGE-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one?
The IUPAC name of 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one (CID 15421911) is 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one.
What is the SMILES notation for 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one?
The canonical SMILES for 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one is Cn1nnc2c(ncn2CO)c1=O.
What is the InChIKey of 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one?
The InChIKey is PYNKESOTRZEPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O2/c1-10-6(13)4-5(8-9-10)11(3-12)2-7-4/h2,12H,3H2,1H3.
What are the key properties of 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one?
7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one has a molecular weight of 181.16 g/mol, XLogP of -1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-3-methylimidazo[4,5-d]triazin-4-one is sourced from PubChem (CID 15421911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).