About 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium
6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium (PubChem CID 15422208) has the molecular formula C16H17N5O2S
and a molecular weight of 343.41 g/mol. Its IUPAC name is 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium.
Molecular Properties
| Compound Name | 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium |
| PubChem CID | 15422208 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium |
| SMILES | C[NH+]1CCOCC1.N#Cc1c(N)nc([S-])c(C#N)c1-c1ccco1 |
| InChI | InChI=1S/C11H6N4OS.C5H11NO/c12-4-6-9(8-2-1-3-16-8)7(5-13)11(17)15-10(6)14;1-6-2-4-7-5-3-6/h1-3H,(H3,14,15,17);2-5H2,1H3 |
| InChIKey | ONAMKAIYBKGUQC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium?
The IUPAC name of 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium (CID 15422208) is 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium.
What is the SMILES notation for 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium?
The canonical SMILES for 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium is C[NH+]1CCOCC1.N#Cc1c(N)nc([S-])c(C#N)c1-c1ccco1.
What is the InChIKey of 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium?
The InChIKey is ONAMKAIYBKGUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N4OS.C5H11NO/c12-4-6-9(8-2-1-3-16-8)7(5-13)11(17)15-10(6)14;1-6-2-4-7-5-3-6/h1-3H,(H3,14,15,17);2-5H2,1H3.
What are the key properties of 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium?
6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium has a molecular weight of 343.41 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,5-dicyano-4-(furan-2-yl)pyridine-2-thiolate;4-methylmorpholin-4-ium is sourced from PubChem (CID 15422208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).