C13H18N6O2 — CID 154222239
1-(benzylideneamino)-6-hydrazinyl-3-propan-2-yl-1,3,5-triazinane-2,4-dione (PubChem CID 154222239) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(benzylideneamino)-6-hydrazinyl-3-propan-2-yl-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-(benzylideneamino)-6-hydrazinyl-3-propan-2-yl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 154222239 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(benzylideneamino)-6-hydrazinyl-3-propan-2-yl-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)N1C(=O)NC(NN)N(N=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C13H18N6O2/c1-9(2)18-12(20)16-11(17-14)19(13(18)21)15-8-10-6-4-3-5-7-10/h3-9,11,17H,14H2,1-2H3,(H,16,20) |
| InChIKey | VRAYSTCEGWOGJJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|