C21H40O3Si2 — CID 15422439
(4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 15422439) has the molecular formula C21H40O3Si2 and a molecular weight of 396.72 g/mol. Its IUPAC name is (4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 15422439 |
| Molecular Formula | C21H40O3Si2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (4S,5S,7aS)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2CC(=O)C=C2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si2/c1-20(2,3)25(7,8)23-18-12-11-15-13-16(22)14-17(15)19(18)24-26(9,10)21(4,5)6/h14-15,18-19H,11-13H2,1-10H3/t15-,18-,19-/m0/s1 |
| InChIKey | YYMGJEFZEOFYBX-SNRMKQJTSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|