C17H32BNO4 — CID 154226343
1-acetamidopentyl-[(2-hydroxy-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)oxy]borinic acid (PubChem CID 154226343) has the molecular formula C17H32BNO4 and a molecular weight of 325.26 g/mol. Its IUPAC name is 1-acetamidopentyl-[(2-hydroxy-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)oxy]borinic acid.
| Compound Name | 1-acetamidopentyl-[(2-hydroxy-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)oxy]borinic acid |
|---|---|
| PubChem CID | 154226343 |
| Molecular Formula | C17H32BNO4 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 1-acetamidopentyl-[(2-hydroxy-2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)oxy]borinic acid |
| SMILES | CCCCC(NC(C)=O)B(O)OC12CC(CCC1(C)O)C2(C)C |
| InChI | InChI=1S/C17H32BNO4/c1-6-7-8-14(19-12(2)20)18(22)23-17-11-13(15(17,3)4)9-10-16(17,5)21/h13-14,21-22H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | PNBJBJBAXJZLQD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|