C25H20N2O4S — CID 154226371
N-(3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 154226371) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is N-(3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 154226371 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-(3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1sc2c(c1C(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C25H20N2O4S/c28-20(14-27-24(30)16-10-4-5-11-17(16)25(27)31)26-23-21(18-12-6-7-13-19(18)32-23)22(29)15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,26,28) |
| InChIKey | FTTOJSCYIHZOFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|