C37H46N2O7 — CID 154228852
N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5,11-dihydroxy-4-(4-nitrophenoxy)tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3-carboxamide (PubChem CID 154228852) has the molecular formula C37H46N2O7 and a molecular weight of 630.78 g/mol. Its IUPAC name is N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5,11-dihydroxy-4-(4-nitrophenoxy)tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3-carboxamide.
| Compound Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5,11-dihydroxy-4-(4-nitrophenoxy)tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3-carboxamide |
|---|---|
| PubChem CID | 154228852 |
| Molecular Formula | C37H46N2O7 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5,11-dihydroxy-4-(4-nitrophenoxy)tricyclo[6.2.1.02,7]undeca-2,4,6-triene-3-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2c(Oc3ccc([N+](=O)[O-])cc3)c(O)cc3c2C2CCC3C2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C37H46N2O7/c1-7-36(3,4)22-10-17-30(28(20-22)37(5,6)8-2)45-19-9-18-38-35(42)32-31-26-16-15-25(33(26)41)27(31)21-29(40)34(32)46-24-13-11-23(12-14-24)39(43)44/h10-14,17,20-21,25-26,33,40-41H,7-9,15-16,18-19H2,1-6H3,(H,38,42) |
| InChIKey | UVSBRJGLAPQPSM-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|