C10H8F3NOS — CID 154229666
1-(trifluoromethyl)-5H-4,1-benzothiazepin-2-one (PubChem CID 154229666) has the molecular formula C10H8F3NOS and a molecular weight of 247.24 g/mol. Its IUPAC name is 1-(trifluoromethyl)-5H-4,1-benzothiazepin-2-one.
| Compound Name | 1-(trifluoromethyl)-5H-4,1-benzothiazepin-2-one |
|---|---|
| PubChem CID | 154229666 |
| Molecular Formula | C10H8F3NOS |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 1-(trifluoromethyl)-5H-4,1-benzothiazepin-2-one |
| SMILES | O=C1CSCc2ccccc2N1C(F)(F)F |
| InChI | InChI=1S/C10H8F3NOS/c11-10(12,13)14-8-4-2-1-3-7(8)5-16-6-9(14)15/h1-4H,5-6H2 |
| InChIKey | WHAJDWICDFEVLZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|