About 6-(chloromethyl)-3H-1,3-benzoxazol-2-one
6-(chloromethyl)-3H-1,3-benzoxazol-2-one (PubChem CID 15422982) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is 6-(chloromethyl)-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-(chloromethyl)-3H-1,3-benzoxazol-2-one |
| PubChem CID | 15422982 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 6-(chloromethyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(CCl)cc2o1 |
| InChI | InChI=1S/C8H6ClNO2/c9-4-5-1-2-6-7(3-5)12-8(11)10-6/h1-3H,4H2,(H,10,11) |
| InChIKey | MYHPYPWWFFXQDY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-3H-1,3-benzoxazol-2-one?
The IUPAC name of 6-(chloromethyl)-3H-1,3-benzoxazol-2-one (CID 15422982) is 6-(chloromethyl)-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-(chloromethyl)-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 6-(chloromethyl)-3H-1,3-benzoxazol-2-one is O=c1[nH]c2ccc(CCl)cc2o1.
What is the InChIKey of 6-(chloromethyl)-3H-1,3-benzoxazol-2-one?
The InChIKey is MYHPYPWWFFXQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2/c9-4-5-1-2-6-7(3-5)12-8(11)10-6/h1-3H,4H2,(H,10,11).
What are the key properties of 6-(chloromethyl)-3H-1,3-benzoxazol-2-one?
6-(chloromethyl)-3H-1,3-benzoxazol-2-one has a molecular weight of 183.59 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 15422982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).