C28H53N3O8Si — CID 154230302
(5-isocyanato-1,3,3-trimethylcyclohexyl)methyl-[1-morpholin-4-yl-3-(3-triethoxysilylpropoxy)propan-2-yl]carbamic acid (PubChem CID 154230302) has the molecular formula C28H53N3O8Si and a molecular weight of 587.83 g/mol. Its IUPAC name is (5-isocyanato-1,3,3-trimethylcyclohexyl)methyl-[1-morpholin-4-yl-3-(3-triethoxysilylpropoxy)propan-2-yl]carbamic acid.
| Compound Name | (5-isocyanato-1,3,3-trimethylcyclohexyl)methyl-[1-morpholin-4-yl-3-(3-triethoxysilylpropoxy)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154230302 |
| Molecular Formula | C28H53N3O8Si |
| Molecular Weight | 587.83 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | (5-isocyanato-1,3,3-trimethylcyclohexyl)methyl-[1-morpholin-4-yl-3-(3-triethoxysilylpropoxy)propan-2-yl]carbamic acid |
| SMILES | CCO[Si](CCCOCC(CN1CCOCC1)N(CC1(C)CC(N=C=O)CC(C)(C)C1)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C28H53N3O8Si/c1-7-37-40(38-8-2,39-9-3)16-10-13-36-20-25(19-30-11-14-35-15-12-30)31(26(33)34)22-28(6)18-24(29-23-32)17-27(4,5)21-28/h24-25H,7-22H2,1-6H3,(H,33,34) |
| InChIKey | ATEIQXQCZHRTOL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|