About 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid
3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid (PubChem CID 154232338) has the molecular formula C18H10F3N3O2
and a molecular weight of 357.29 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid |
| PubChem CID | 154232338 |
| Molecular Formula | C18H10F3N3O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1[nH]c1nnc(-c3cccc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C18H10F3N3O2/c19-18(20,21)10-4-1-3-9(7-10)14-8-13-11-5-2-6-12(17(25)26)15(11)22-16(13)24-23-14/h1-8H,(H,22,24)(H,25,26) |
| InChIKey | NQTBZQJSGSCPDG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid?
The IUPAC name of 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid (CID 154232338) is 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid.
What is the SMILES notation for 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid?
The canonical SMILES for 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid is O=C(O)c1cccc2c1[nH]c1nnc(-c3cccc(C(F)(F)F)c3)cc12.
What is the InChIKey of 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid?
The InChIKey is NQTBZQJSGSCPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3N3O2/c19-18(20,21)10-4-1-3-9(7-10)14-8-13-11-5-2-6-12(17(25)26)15(11)22-16(13)24-23-14/h1-8H,(H,22,24)(H,25,26).
What are the key properties of 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid?
3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid has a molecular weight of 357.29 g/mol, XLogP of 4.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(trifluoromethyl)phenyl]-9H-pyridazino[3,4-b]indole-8-carboxylic acid is sourced from PubChem (CID 154232338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).