C29H39F5O — CID 154233287
9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2-pentafluorononan-3-ol (PubChem CID 154233287) has the molecular formula C29H39F5O and a molecular weight of 498.62 g/mol. Its IUPAC name is 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2-pentafluorononan-3-ol.
| Compound Name | 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2-pentafluorononan-3-ol |
|---|---|
| PubChem CID | 154233287 |
| Molecular Formula | C29H39F5O |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2-pentafluorononan-3-ol |
| SMILES | C=C[C@@]12CCc3cc(CCCCCCC(O)C(F)(F)C(F)(F)F)ccc3[C@H]1CC[C@]1(C)CCC[C@H]12 |
| InChI | InChI=1S/C29H39F5O/c1-3-27-18-14-21-19-20(9-6-4-5-7-11-25(35)28(30,31)29(32,33)34)12-13-22(21)23(27)15-17-26(2)16-8-10-24(26)27/h3,12-13,19,23-25,35H,1,4-11,14-18H2,2H3/t23-,24-,25?,26+,27-/m1/s1 |
| InChIKey | SBHNVECUSTYKJD-OSKLNTDESA-N |
| XLogP | 8.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|