About 2-chloro-1,2,4-benzothiadiazine
2-chloro-1,2,4-benzothiadiazine (PubChem CID 154233622) has the molecular formula C7H5ClN2S
and a molecular weight of 184.65 g/mol. Its IUPAC name is 2-chloro-1,2,4-benzothiadiazine.
Molecular Properties
| Compound Name | 2-chloro-1,2,4-benzothiadiazine |
| PubChem CID | 154233622 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.65 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 2-chloro-1,2,4-benzothiadiazine |
| SMILES | ClN1C=Nc2ccccc2S1 |
| InChI | InChI=1S/C7H5ClN2S/c8-10-5-9-6-3-1-2-4-7(6)11-10/h1-5H |
| InChIKey | AMRNXWOJTOANGP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,2,4-benzothiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,2,4-benzothiadiazine?
The IUPAC name of 2-chloro-1,2,4-benzothiadiazine (CID 154233622) is 2-chloro-1,2,4-benzothiadiazine.
What is the SMILES notation for 2-chloro-1,2,4-benzothiadiazine?
The canonical SMILES for 2-chloro-1,2,4-benzothiadiazine is ClN1C=Nc2ccccc2S1.
What is the InChIKey of 2-chloro-1,2,4-benzothiadiazine?
The InChIKey is AMRNXWOJTOANGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2S/c8-10-5-9-6-3-1-2-4-7(6)11-10/h1-5H.
What are the key properties of 2-chloro-1,2,4-benzothiadiazine?
2-chloro-1,2,4-benzothiadiazine has a molecular weight of 184.65 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,2,4-benzothiadiazine is sourced from PubChem (CID 154233622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).