C24H19N5O — CID 154235209
1-(4-aminophenyl)-4-(4-phenoxyphenyl)pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 154235209) has the molecular formula C24H19N5O and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-(4-aminophenyl)-4-(4-phenoxyphenyl)pyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 1-(4-aminophenyl)-4-(4-phenoxyphenyl)pyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 154235209 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-(4-aminophenyl)-4-(4-phenoxyphenyl)pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Nc1ccc(-n2nc(N)c3c(-c4ccc(Oc5ccccc5)cc4)ccnc32)cc1 |
| InChI | InChI=1S/C24H19N5O/c25-17-8-10-18(11-9-17)29-24-22(23(26)28-29)21(14-15-27-24)16-6-12-20(13-7-16)30-19-4-2-1-3-5-19/h1-15H,25H2,(H2,26,28) |
| InChIKey | VVGKKOOEVIMEAW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|