C18H22N6O5 — CID 154236127
(2S)-2-[[[2-(N'-hydroxycarbamimidoyl)-4-(4-methoxyphenoxy)pyrimidin-5-yl]amino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 154236127) has the molecular formula C18H22N6O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is (2S)-2-[[[2-(N'-hydroxycarbamimidoyl)-4-(4-methoxyphenoxy)pyrimidin-5-yl]amino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-[[[2-(N'-hydroxycarbamimidoyl)-4-(4-methoxyphenoxy)pyrimidin-5-yl]amino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154236127 |
| Molecular Formula | C18H22N6O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2S)-2-[[[2-(N'-hydroxycarbamimidoyl)-4-(4-methoxyphenoxy)pyrimidin-5-yl]amino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | COc1ccc(Oc2nc(C(N)=NO)ncc2NC[C@@H]2CCCN2C(=O)O)cc1 |
| InChI | InChI=1S/C18H22N6O5/c1-28-12-4-6-13(7-5-12)29-17-14(10-21-16(22-17)15(19)23-27)20-9-11-3-2-8-24(11)18(25)26/h4-7,10-11,20,27H,2-3,8-9H2,1H3,(H2,19,23)(H,25,26)/t11-/m0/s1 |
| InChIKey | RTMVUBBYSPYUBR-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|