About (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol
(2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol (PubChem CID 15423628) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol.
Molecular Properties
| Compound Name | (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol |
| PubChem CID | 15423628 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol |
| SMILES | CC(c1ccccc1)[C@@H]1CC(O)C=CO1 |
| InChI | InChI=1S/C13H16O2/c1-10(11-5-3-2-4-6-11)13-9-12(14)7-8-15-13/h2-8,10,12-14H,9H2,1H3/t10?,12?,13-/m0/s1 |
| InChIKey | ZAHIAPSTWSWYNF-GDKBPFBDSA-N |
| XLogP | 2.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol?
The IUPAC name of (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol (CID 15423628) is (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol.
What is the SMILES notation for (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol?
The canonical SMILES for (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol is CC(c1ccccc1)[C@@H]1CC(O)C=CO1.
What is the InChIKey of (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol?
The InChIKey is ZAHIAPSTWSWYNF-GDKBPFBDSA-N. The full InChI is InChI=1S/C13H16O2/c1-10(11-5-3-2-4-6-11)13-9-12(14)7-8-15-13/h2-8,10,12-14H,9H2,1H3/t10?,12?,13-/m0/s1.
What are the key properties of (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol?
(2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol has a molecular weight of 204.27 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1-phenylethyl)-3,4-dihydro-2H-pyran-4-ol is sourced from PubChem (CID 15423628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).