C20H40N2O — CID 154238302
2,2-bis[(dipropylamino)methyl]cyclohexan-1-one (PubChem CID 154238302) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is 2,2-bis[(dipropylamino)methyl]cyclohexan-1-one.
| Compound Name | 2,2-bis[(dipropylamino)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 154238302 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | 2,2-bis[(dipropylamino)methyl]cyclohexan-1-one |
| SMILES | CCCN(CCC)CC1(CN(CCC)CCC)CCCCC1=O |
| InChI | InChI=1S/C20H40N2O/c1-5-13-21(14-6-2)17-20(12-10-9-11-19(20)23)18-22(15-7-3)16-8-4/h5-18H2,1-4H3 |
| InChIKey | QZHBHNNFIVIYSN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |