C13H16O4 — CID 154238387
2-(1-propylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione (PubChem CID 154238387) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(1-propylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(1-propylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 154238387 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(1-propylcyclohexa-2,4-dien-1-yl)-1,3-dioxane-4,6-dione |
| SMILES | CCCC1(C2OC(=O)CC(=O)O2)C=CC=CC1 |
| InChI | InChI=1S/C13H16O4/c1-2-6-13(7-4-3-5-8-13)12-16-10(14)9-11(15)17-12/h3-5,7,12H,2,6,8-9H2,1H3 |
| InChIKey | XVDVHNASRODNGP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|