C13H20N2O4S — CID 154238727
(2R,3R)-2-amino-3-hydroxy-2-(4-propylphenyl)sulfonylbutanamide (PubChem CID 154238727) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is (2R,3R)-2-amino-3-hydroxy-2-(4-propylphenyl)sulfonylbutanamide.
| Compound Name | (2R,3R)-2-amino-3-hydroxy-2-(4-propylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 154238727 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2R,3R)-2-amino-3-hydroxy-2-(4-propylphenyl)sulfonylbutanamide |
| SMILES | CCCc1ccc(S(=O)(=O)[C@@](N)(C(N)=O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C13H20N2O4S/c1-3-4-10-5-7-11(8-6-10)20(18,19)13(15,9(2)16)12(14)17/h5-9,16H,3-4,15H2,1-2H3,(H2,14,17)/t9-,13-/m1/s1 |
| InChIKey | KNUYIHUTYBUJMR-NOZJJQNGSA-N |
| XLogP | -0.07 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |