C6H5F5O2 — CID 154239641
2-(1,1,2,2,2-pentafluoroethyl)butanedial (PubChem CID 154239641) has the molecular formula C6H5F5O2 and a molecular weight of 204.09 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)butanedial.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)butanedial |
|---|---|
| PubChem CID | 154239641 |
| Molecular Formula | C6H5F5O2 |
| Molecular Weight | 204.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)butanedial |
| SMILES | O=CCC(C=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5O2/c7-5(8,6(9,10)11)4(3-13)1-2-12/h2-4H,1H2 |
| InChIKey | CUYFOJHYYUFDAU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.09 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|