C22H31ClN2O6S — CID 154239842
[(2R,3S,4S,4aS,10aR)-3-acetyloxy-3-chloro-10-[2-(diethylamino)ethyl]-4-hydroxy-2,4,4a,10a-tetrahydropyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate (PubChem CID 154239842) has the molecular formula C22H31ClN2O6S and a molecular weight of 487.02 g/mol. Its IUPAC name is [(2R,3S,4S,4aS,10aR)-3-acetyloxy-3-chloro-10-[2-(diethylamino)ethyl]-4-hydroxy-2,4,4a,10a-tetrahydropyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,4aS,10aR)-3-acetyloxy-3-chloro-10-[2-(diethylamino)ethyl]-4-hydroxy-2,4,4a,10a-tetrahydropyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 154239842 |
| Molecular Formula | C22H31ClN2O6S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [(2R,3S,4S,4aS,10aR)-3-acetyloxy-3-chloro-10-[2-(diethylamino)ethyl]-4-hydroxy-2,4,4a,10a-tetrahydropyrano[3,2-b][1,4]benzothiazin-2-yl]methyl acetate |
| SMILES | CCN(CC)CCN1c2ccccc2S[C@@H]2[C@H]1O[C@H](COC(C)=O)[C@](Cl)(OC(C)=O)[C@H]2O |
| InChI | InChI=1S/C22H31ClN2O6S/c1-5-24(6-2)11-12-25-16-9-7-8-10-17(16)32-19-20(28)22(23,31-15(4)27)18(30-21(19)25)13-29-14(3)26/h7-10,18-21,28H,5-6,11-13H2,1-4H3/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | XIBGXTBKTVGFDR-CTWRKMMKSA-N |
| XLogP | 2.46 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|