C7H12F3N3O4 — CID 154239977
N-(2,2-dinitropropyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 154239977) has the molecular formula C7H12F3N3O4 and a molecular weight of 259.18 g/mol. Its IUPAC name is N-(2,2-dinitropropyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-(2,2-dinitropropyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 154239977 |
| Molecular Formula | C7H12F3N3O4 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(2,2-dinitropropyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(CNCCCC(F)(F)F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H12F3N3O4/c1-6(12(14)15,13(16)17)5-11-4-2-3-7(8,9)10/h11H,2-5H2,1H3 |
| InChIKey | LHHJOGRTFPPMCE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|