About tributyl(hepta-1,2-dienyl)stannane
tributyl(hepta-1,2-dienyl)stannane (PubChem CID 15424020) has the molecular formula C19H38Sn
and a molecular weight of 385.22 g/mol. Its IUPAC name is tributyl(hepta-1,2-dienyl)stannane.
Molecular Properties
| Compound Name | tributyl(hepta-1,2-dienyl)stannane |
| PubChem CID | 15424020 |
| Molecular Formula | C19H38Sn |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tributyl(hepta-1,2-dienyl)stannane |
| SMILES | CCCCC=C=C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C7H11.3C4H9.Sn/c1-3-5-7-6-4-2;3*1-3-4-2;/h1,5H,4,6-7H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | DEEFFMNRTXMPDY-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tributyl(hepta-1,2-dienyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(hepta-1,2-dienyl)stannane?
The IUPAC name of tributyl(hepta-1,2-dienyl)stannane (CID 15424020) is tributyl(hepta-1,2-dienyl)stannane.
What is the SMILES notation for tributyl(hepta-1,2-dienyl)stannane?
The canonical SMILES for tributyl(hepta-1,2-dienyl)stannane is CCCCC=C=C[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl(hepta-1,2-dienyl)stannane?
The InChIKey is DEEFFMNRTXMPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11.3C4H9.Sn/c1-3-5-7-6-4-2;3*1-3-4-2;/h1,5H,4,6-7H2,2H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl(hepta-1,2-dienyl)stannane?
tributyl(hepta-1,2-dienyl)stannane has a molecular weight of 385.22 g/mol, XLogP of 7.28, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(hepta-1,2-dienyl)stannane is sourced from PubChem (CID 15424020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).