C15H16OS — CID 15424085
phenyl(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanol (PubChem CID 15424085) has the molecular formula C15H16OS and a molecular weight of 244.36 g/mol. Its IUPAC name is phenyl(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanol.
| Compound Name | phenyl(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 15424085 |
| Molecular Formula | C15H16OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | phenyl(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanol |
| SMILES | OC(c1ccccc1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H16OS/c16-15(11-6-2-1-3-7-11)14-10-12-8-4-5-9-13(12)17-14/h1-3,6-7,10,15-16H,4-5,8-9H2 |
| InChIKey | XPWXDWMQUIUSCO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |