C14H19N3O3 — CID 154242747
(9R,13R)-5-(hydroxymethyl)-4,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylic acid (PubChem CID 154242747) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (9R,13R)-5-(hydroxymethyl)-4,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylic acid.
| Compound Name | (9R,13R)-5-(hydroxymethyl)-4,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 154242747 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (9R,13R)-5-(hydroxymethyl)-4,13-dimethyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene-11-carboxylic acid |
| SMILES | Cc1nc2c(cc1CO)C[C@@H]1CN(C(=O)O)C[C@@H](C)N21 |
| InChI | InChI=1S/C14H19N3O3/c1-8-5-16(14(19)20)6-12-4-10-3-11(7-18)9(2)15-13(10)17(8)12/h3,8,12,18H,4-7H2,1-2H3,(H,19,20)/t8-,12-/m1/s1 |
| InChIKey | GSOCWJANIJIMHS-PRHODGIISA-N |
| XLogP | 1.00 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |